C15H20ClN3O2 — CID 66131103
2-chloro-4,5-dimethoxy-N-[(3-propan-2-ylimidazol-4-yl)methyl]aniline (PubChem CID 66131103) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 2-chloro-4,5-dimethoxy-N-[(3-propan-2-ylimidazol-4-yl)methyl]aniline.
| Compound Name | 2-chloro-4,5-dimethoxy-N-[(3-propan-2-ylimidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 66131103 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-chloro-4,5-dimethoxy-N-[(3-propan-2-ylimidazol-4-yl)methyl]aniline |
| SMILES | COc1cc(Cl)c(NCc2cncn2C(C)C)cc1OC |
| InChI | InChI=1S/C15H20ClN3O2/c1-10(2)19-9-17-7-11(19)8-18-13-6-15(21-4)14(20-3)5-12(13)16/h5-7,9-10,18H,8H2,1-4H3 |
| InChIKey | CIKVSWQMTCPIOT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|