C18H28O6 — CID 6613118
(6R,7S,14R,15S)-7,15-dimethoxy-6,14-dimethyl-1,9-dioxacyclohexadeca-4,12-diene-2,10-dione (PubChem CID 6613118) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is (6R,7S,14R,15S)-7,15-dimethoxy-6,14-dimethyl-1,9-dioxacyclohexadeca-4,12-diene-2,10-dione.
| Compound Name | (6R,7S,14R,15S)-7,15-dimethoxy-6,14-dimethyl-1,9-dioxacyclohexadeca-4,12-diene-2,10-dione |
|---|---|
| PubChem CID | 6613118 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (6R,7S,14R,15S)-7,15-dimethoxy-6,14-dimethyl-1,9-dioxacyclohexadeca-4,12-diene-2,10-dione |
| SMILES | CO[C@@H]1COC(=O)CC=C[C@@H](C)[C@H](OC)COC(=O)CC=C[C@H]1C |
| InChI | InChI=1S/C18H28O6/c1-13-7-5-9-17(19)24-12-16(22-4)14(2)8-6-10-18(20)23-11-15(13)21-3/h5-8,13-16H,9-12H2,1-4H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | XHGSXZXWBLXYTP-KLHDSHLOSA-N |
| XLogP | 2.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|