C13H14Cl3N3 — CID 66135198
2,4,6-trichloro-N-[(3-propylimidazol-4-yl)methyl]aniline (PubChem CID 66135198) has the molecular formula C13H14Cl3N3 and a molecular weight of 318.64 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(3-propylimidazol-4-yl)methyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[(3-propylimidazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 66135198 |
| Molecular Formula | C13H14Cl3N3 |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2,4,6-trichloro-N-[(3-propylimidazol-4-yl)methyl]aniline |
| SMILES | CCCn1cncc1CNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl3N3/c1-2-3-19-8-17-6-10(19)7-18-13-11(15)4-9(14)5-12(13)16/h4-6,8,18H,2-3,7H2,1H3 |
| InChIKey | IVZDZJXAHNGTAL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |