About 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine
6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 66135706) has the molecular formula C12H11Cl2N5
and a molecular weight of 296.16 g/mol. Its IUPAC name is 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 66135706 |
| Molecular Formula | C12H11Cl2N5 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | CCn1cncc1-c1nc2c(Cl)cc(Cl)cn2c1N |
| InChI | InChI=1S/C12H11Cl2N5/c1-2-18-6-16-4-9(18)10-11(15)19-5-7(13)3-8(14)12(19)17-10/h3-6H,2,15H2,1H3 |
| InChIKey | DYPDJAQTQCAYFN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine (CID 66135706) is 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine is CCn1cncc1-c1nc2c(Cl)cc(Cl)cn2c1N.
What is the InChIKey of 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine?
The InChIKey is DYPDJAQTQCAYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N5/c1-2-18-6-16-4-9(18)10-11(15)19-5-7(13)3-8(14)12(19)17-10/h3-6H,2,15H2,1H3.
What are the key properties of 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine?
6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine has a molecular weight of 296.16 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-2-(3-ethylimidazol-4-yl)imidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 66135706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).