About 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol
3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol (PubChem CID 66137458) has the molecular formula C9H16N2OS2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol.
Molecular Properties
| Compound Name | 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol |
| PubChem CID | 66137458 |
| Molecular Formula | C9H16N2OS2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol |
| SMILES | CC(CCO)Sc1nc(C(C)C)ns1 |
| InChI | InChI=1S/C9H16N2OS2/c1-6(2)8-10-9(14-11-8)13-7(3)4-5-12/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | JFXAAGFDMRMNNC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol?
The IUPAC name of 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol (CID 66137458) is 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol.
What is the SMILES notation for 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol?
The canonical SMILES for 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol is CC(CCO)Sc1nc(C(C)C)ns1.
What is the InChIKey of 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol?
The InChIKey is JFXAAGFDMRMNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS2/c1-6(2)8-10-9(14-11-8)13-7(3)4-5-12/h6-7,12H,4-5H2,1-3H3.
What are the key properties of 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol?
3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol has a molecular weight of 232.37 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-propan-2-yl-1,2,4-thiadiazol-5-yl)sulfanyl]butan-1-ol is sourced from PubChem (CID 66137458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).