About 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol
3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol (PubChem CID 66138340) has the molecular formula C8H12ClN3O2S
and a molecular weight of 249.72 g/mol. Its IUPAC name is 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol |
| PubChem CID | 66138340 |
| Molecular Formula | C8H12ClN3O2S |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol |
| SMILES | COc1nc(Cl)nc(SC(C)CCO)n1 |
| InChI | InChI=1S/C8H12ClN3O2S/c1-5(3-4-13)15-8-11-6(9)10-7(12-8)14-2/h5,13H,3-4H2,1-2H3 |
| InChIKey | QEHHCNKNIVEXEF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol?
The IUPAC name of 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol (CID 66138340) is 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol.
What is the SMILES notation for 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol?
The canonical SMILES for 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol is COc1nc(Cl)nc(SC(C)CCO)n1.
What is the InChIKey of 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol?
The InChIKey is QEHHCNKNIVEXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClN3O2S/c1-5(3-4-13)15-8-11-6(9)10-7(12-8)14-2/h5,13H,3-4H2,1-2H3.
What are the key properties of 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol?
3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol has a molecular weight of 249.72 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]butan-1-ol is sourced from PubChem (CID 66138340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).