C9H14ClN3O2S — CID 66138773
2-(4-chlorobutan-2-ylsulfanyl)-4,6-dimethoxy-1,3,5-triazine (PubChem CID 66138773) has the molecular formula C9H14ClN3O2S and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-(4-chlorobutan-2-ylsulfanyl)-4,6-dimethoxy-1,3,5-triazine.
| Compound Name | 2-(4-chlorobutan-2-ylsulfanyl)-4,6-dimethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 66138773 |
| Molecular Formula | C9H14ClN3O2S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-(4-chlorobutan-2-ylsulfanyl)-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(SC(C)CCCl)n1 |
| InChI | InChI=1S/C9H14ClN3O2S/c1-6(4-5-10)16-9-12-7(14-2)11-8(13-9)15-3/h6H,4-5H2,1-3H3 |
| InChIKey | QOYSNKKNKNSLLA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|