C26H30N2O5 — CID 6613902
N-[(1R)-2-hydroxy-1-phenylethyl]-11-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-ene-6-carboxamide (PubChem CID 6613902) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-[(1R)-2-hydroxy-1-phenylethyl]-11-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-ene-6-carboxamide.
| Compound Name | N-[(1R)-2-hydroxy-1-phenylethyl]-11-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 6613902 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-[(1R)-2-hydroxy-1-phenylethyl]-11-methyl-5,12-dioxo-3-phenyl-1-oxa-4-azacyclododec-8-ene-6-carboxamide |
| SMILES | CC1CC=CCC(C(=O)N[C@@H](CO)c2ccccc2)C(=O)NC(c2ccccc2)COC1=O |
| InChI | InChI=1S/C26H30N2O5/c1-18-10-8-9-15-21(24(30)27-22(16-29)19-11-4-2-5-12-19)25(31)28-23(17-33-26(18)32)20-13-6-3-7-14-20/h2-9,11-14,18,21-23,29H,10,15-17H2,1H3,(H,27,30)(H,28,31)/t18?,21?,22-,23?/m0/s1 |
| InChIKey | NPRIBWNWPMDSQU-KJYDKAEJSA-N |
| XLogP | 2.84 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|