C33H36N2O5 — CID 6613907
3,11-dibenzyl-N-[(1R)-2-hydroxy-1-phenylethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-6-carboxamide (PubChem CID 6613907) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is 3,11-dibenzyl-N-[(1R)-2-hydroxy-1-phenylethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-6-carboxamide.
| Compound Name | 3,11-dibenzyl-N-[(1R)-2-hydroxy-1-phenylethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 6613907 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 3,11-dibenzyl-N-[(1R)-2-hydroxy-1-phenylethyl]-5,12-dioxo-1-oxa-4-azacyclododec-8-ene-6-carboxamide |
| SMILES | O=C1OCC(Cc2ccccc2)NC(=O)C(C(=O)N[C@@H](CO)c2ccccc2)CC=CCC1Cc1ccccc1 |
| InChI | InChI=1S/C33H36N2O5/c36-22-30(26-16-8-3-9-17-26)35-32(38)29-19-11-10-18-27(20-24-12-4-1-5-13-24)33(39)40-23-28(34-31(29)37)21-25-14-6-2-7-15-25/h1-17,27-30,36H,18-23H2,(H,34,37)(H,35,38)/t27?,28?,29?,30-/m0/s1 |
| InChIKey | KNISHIWKFMOSLU-IYCLCUOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|