C15H24ClNS — CID 66141176
1-(2-chlorophenyl)sulfanyl-4-methyl-N-propylpentan-2-amine (PubChem CID 66141176) has the molecular formula C15H24ClNS and a molecular weight of 285.88 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-4-methyl-N-propylpentan-2-amine.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-4-methyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 66141176 |
| Molecular Formula | C15H24ClNS |
| Molecular Weight | 285.88 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-4-methyl-N-propylpentan-2-amine |
| SMILES | CCCNC(CSc1ccccc1Cl)CC(C)C |
| InChI | InChI=1S/C15H24ClNS/c1-4-9-17-13(10-12(2)3)11-18-15-8-6-5-7-14(15)16/h5-8,12-13,17H,4,9-11H2,1-3H3 |
| InChIKey | WFNTWJOGKQMOBD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.88 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |