C15H19N3O2S — CID 66141193
N-[(3-cyclopropylimidazol-4-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine (PubChem CID 66141193) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[(3-cyclopropylimidazol-4-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine.
| Compound Name | N-[(3-cyclopropylimidazol-4-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine |
|---|---|
| PubChem CID | 66141193 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(3-cyclopropylimidazol-4-yl)methyl]-1-(4-methylsulfonylphenyl)methanamine |
| SMILES | CS(=O)(=O)c1ccc(CNCc2cncn2C2CC2)cc1 |
| InChI | InChI=1S/C15H19N3O2S/c1-21(19,20)15-6-2-12(3-7-15)8-16-9-14-10-17-11-18(14)13-4-5-13/h2-3,6-7,10-11,13,16H,4-5,8-9H2,1H3 |
| InChIKey | DVUVCKYFAMTANU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |