C16H20ClNS2 — CID 66143413
N-[2-(4-chlorophenyl)sulfanyl-1-(5-methylthiophen-3-yl)ethyl]propan-1-amine (PubChem CID 66143413) has the molecular formula C16H20ClNS2 and a molecular weight of 325.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanyl-1-(5-methylthiophen-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2-(4-chlorophenyl)sulfanyl-1-(5-methylthiophen-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 66143413 |
| Molecular Formula | C16H20ClNS2 |
| Molecular Weight | 325.93 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanyl-1-(5-methylthiophen-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(CSc1ccc(Cl)cc1)c1csc(C)c1 |
| InChI | InChI=1S/C16H20ClNS2/c1-3-8-18-16(13-9-12(2)19-10-13)11-20-15-6-4-14(17)5-7-15/h4-7,9-10,16,18H,3,8,11H2,1-2H3 |
| InChIKey | SMEMOWBCDRWHPX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.93 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |