C11H15BrOS — CID 66144436
1-(2-bromophenyl)sulfanylpentan-2-ol (PubChem CID 66144436) has the molecular formula C11H15BrOS and a molecular weight of 275.21 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfanylpentan-2-ol.
| Compound Name | 1-(2-bromophenyl)sulfanylpentan-2-ol |
|---|---|
| PubChem CID | 66144436 |
| Molecular Formula | C11H15BrOS |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-(2-bromophenyl)sulfanylpentan-2-ol |
| SMILES | CCCC(O)CSc1ccccc1Br |
| InChI | InChI=1S/C11H15BrOS/c1-2-5-9(13)8-14-11-7-4-3-6-10(11)12/h3-4,6-7,9,13H,2,5,8H2,1H3 |
| InChIKey | NEZMUUITCRYEDS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |