C16H12N6O — CID 6614471
N-[3-(furan-2-yl)prop-2-enylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6614471) has the molecular formula C16H12N6O and a molecular weight of 304.31 g/mol. Its IUPAC name is N-[3-(furan-2-yl)prop-2-enylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[3-(furan-2-yl)prop-2-enylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6614471 |
| Molecular Formula | C16H12N6O |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[3-(furan-2-yl)prop-2-enylideneamino]-5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | C(=Cc1ccco1)C=NNc1nnc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C16H12N6O/c1-2-8-13-12(7-1)14-15(18-13)19-16(22-20-14)21-17-9-3-5-11-6-4-10-23-11/h1-10H,(H2,18,19,21,22) |
| InChIKey | QWNMINFAORNMIJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|