C12H20N2OS — CID 66146156
3-(3,4-dimethylcyclohexyl)-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 66146156) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-(3,4-dimethylcyclohexyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66146156 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | CC1CCC(n2c(CO)c[nH]c2=S)CC1C |
| InChI | InChI=1S/C12H20N2OS/c1-8-3-4-10(5-9(8)2)14-11(7-15)6-13-12(14)16/h6,8-10,15H,3-5,7H2,1-2H3,(H,13,16) |
| InChIKey | IOFSVQZHFIUQDE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|