About 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde
3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde (PubChem CID 66146176) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde |
| PubChem CID | 66146176 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde |
| SMILES | CC1CC(C)CC(n2cncc2C=O)C1 |
| InChI | InChI=1S/C12H18N2O/c1-9-3-10(2)5-11(4-9)14-8-13-6-12(14)7-15/h6-11H,3-5H2,1-2H3 |
| InChIKey | PVMQOTMEMKKKQJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde?
The IUPAC name of 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde (CID 66146176) is 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde.
What is the SMILES notation for 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde?
The canonical SMILES for 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde is CC1CC(C)CC(n2cncc2C=O)C1.
What is the InChIKey of 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde?
The InChIKey is PVMQOTMEMKKKQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O/c1-9-3-10(2)5-11(4-9)14-8-13-6-12(14)7-15/h6-11H,3-5H2,1-2H3.
What are the key properties of 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde?
3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde has a molecular weight of 206.29 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylcyclohexyl)imidazole-4-carbaldehyde is sourced from PubChem (CID 66146176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).