C15H22N4 — CID 66146733
2-methyl-N-[[3-(1-pyridin-4-ylethyl)imidazol-4-yl]methyl]propan-1-amine (PubChem CID 66146733) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-methyl-N-[[3-(1-pyridin-4-ylethyl)imidazol-4-yl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[3-(1-pyridin-4-ylethyl)imidazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66146733 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-methyl-N-[[3-(1-pyridin-4-ylethyl)imidazol-4-yl]methyl]propan-1-amine |
| SMILES | CC(C)CNCc1cncn1C(C)c1ccncc1 |
| InChI | InChI=1S/C15H22N4/c1-12(2)8-17-9-15-10-18-11-19(15)13(3)14-4-6-16-7-5-14/h4-7,10-13,17H,8-9H2,1-3H3 |
| InChIKey | FALXGINCWHTJDM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |