About N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine
N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine (PubChem CID 66147536) has the molecular formula C16H21Cl2N3
and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 66147536 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(c1ccc(Cl)cc1Cl)n1cncc1CNC(C)(C)C |
| InChI | InChI=1S/C16H21Cl2N3/c1-11(14-6-5-12(17)7-15(14)18)21-10-19-8-13(21)9-20-16(2,3)4/h5-8,10-11,20H,9H2,1-4H3 |
| InChIKey | HDVLSWLNLIYNMM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine (CID 66147536) is N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine is CC(c1ccc(Cl)cc1Cl)n1cncc1CNC(C)(C)C.
What is the InChIKey of N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine?
The InChIKey is HDVLSWLNLIYNMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21Cl2N3/c1-11(14-6-5-12(17)7-15(14)18)21-10-19-8-13(21)9-20-16(2,3)4/h5-8,10-11,20H,9H2,1-4H3.
What are the key properties of N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine?
N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine has a molecular weight of 326.27 g/mol, XLogP of 4.69, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[1-(2,4-dichlorophenyl)ethyl]imidazol-4-yl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 66147536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).