C14H13ClN2O2S — CID 66148532
2-[(3-chlorophenyl)sulfanylmethyl]-4-ethylpyrimidine-5-carboxylic acid (PubChem CID 66148532) has the molecular formula C14H13ClN2O2S and a molecular weight of 308.79 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfanylmethyl]-4-ethylpyrimidine-5-carboxylic acid.
| Compound Name | 2-[(3-chlorophenyl)sulfanylmethyl]-4-ethylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 66148532 |
| Molecular Formula | C14H13ClN2O2S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfanylmethyl]-4-ethylpyrimidine-5-carboxylic acid |
| SMILES | CCc1nc(CSc2cccc(Cl)c2)ncc1C(=O)O |
| InChI | InChI=1S/C14H13ClN2O2S/c1-2-12-11(14(18)19)7-16-13(17-12)8-20-10-5-3-4-9(15)6-10/h3-7H,2,8H2,1H3,(H,18,19) |
| InChIKey | ZXRAYQMLBYRNLN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |