C13H10F3N3OS — CID 66149024
4-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanyl-2-(trifluoromethyl)benzonitrile (PubChem CID 66149024) has the molecular formula C13H10F3N3OS and a molecular weight of 313.30 g/mol. Its IUPAC name is 4-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanyl-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanyl-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 66149024 |
| Molecular Formula | C13H10F3N3OS |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanyl-2-(trifluoromethyl)benzonitrile |
| SMILES | Cn1c(CO)cnc1Sc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3N3OS/c1-19-9(7-20)6-18-12(19)21-10-3-2-8(5-17)11(4-10)13(14,15)16/h2-4,6,20H,7H2,1H3 |
| InChIKey | BQUXFWKLFDSOFM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |