C12H11ClF2N2 — CID 66149176
5-(chloromethyl)-1-[2-(3,5-difluorophenyl)ethyl]imidazole (PubChem CID 66149176) has the molecular formula C12H11ClF2N2 and a molecular weight of 256.68 g/mol. Its IUPAC name is 5-(chloromethyl)-1-[2-(3,5-difluorophenyl)ethyl]imidazole.
| Compound Name | 5-(chloromethyl)-1-[2-(3,5-difluorophenyl)ethyl]imidazole |
|---|---|
| PubChem CID | 66149176 |
| Molecular Formula | C12H11ClF2N2 |
| Molecular Weight | 256.68 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-(chloromethyl)-1-[2-(3,5-difluorophenyl)ethyl]imidazole |
| SMILES | Fc1cc(F)cc(CCn2cncc2CCl)c1 |
| InChI | InChI=1S/C12H11ClF2N2/c13-6-12-7-16-8-17(12)2-1-9-3-10(14)5-11(15)4-9/h3-5,7-8H,1-2,6H2 |
| InChIKey | SJVBXFKETRDKQE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.68 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|