C10H17ClN2 — CID 66149387
5-(chloromethyl)-1-(2,3-dimethylbutyl)imidazole (PubChem CID 66149387) has the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. Its IUPAC name is 5-(chloromethyl)-1-(2,3-dimethylbutyl)imidazole.
| Compound Name | 5-(chloromethyl)-1-(2,3-dimethylbutyl)imidazole |
|---|---|
| PubChem CID | 66149387 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-(chloromethyl)-1-(2,3-dimethylbutyl)imidazole |
| SMILES | CC(C)C(C)Cn1cncc1CCl |
| InChI | InChI=1S/C10H17ClN2/c1-8(2)9(3)6-13-7-12-5-10(13)4-11/h5,7-9H,4,6H2,1-3H3 |
| InChIKey | FCOHFOYQUYXCDO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|