About 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one
2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one (PubChem CID 66149817) has the molecular formula C11H13N3O4S
and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one |
| PubChem CID | 66149817 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one |
| SMILES | Cc1cc(=O)n(C(=O)CSc2ncc(CO)n2C)o1 |
| InChI | InChI=1S/C11H13N3O4S/c1-7-3-9(16)14(18-7)10(17)6-19-11-12-4-8(5-15)13(11)2/h3-4,15H,5-6H2,1-2H3 |
| InChIKey | FIDYNQRHOKWAOP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 90.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one?
The IUPAC name of 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one (CID 66149817) is 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one.
What is the SMILES notation for 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one?
The canonical SMILES for 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one is Cc1cc(=O)n(C(=O)CSc2ncc(CO)n2C)o1.
What is the InChIKey of 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one?
The InChIKey is FIDYNQRHOKWAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O4S/c1-7-3-9(16)14(18-7)10(17)6-19-11-12-4-8(5-15)13(11)2/h3-4,15H,5-6H2,1-2H3.
What are the key properties of 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one?
2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one has a molecular weight of 283.31 g/mol, XLogP of 0.41, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[5-(hydroxymethyl)-1-methylimidazol-2-yl]sulfanylacetyl]-5-methyl-1,2-oxazol-3-one is sourced from PubChem (CID 66149817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).