C10H20N4 — CID 66149923
N-ethyl-N-methyl-2-[5-(methylaminomethyl)imidazol-1-yl]ethanamine (PubChem CID 66149923) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-[5-(methylaminomethyl)imidazol-1-yl]ethanamine.
| Compound Name | N-ethyl-N-methyl-2-[5-(methylaminomethyl)imidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 66149923 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | N-ethyl-N-methyl-2-[5-(methylaminomethyl)imidazol-1-yl]ethanamine |
| SMILES | CCN(C)CCn1cncc1CNC |
| InChI | InChI=1S/C10H20N4/c1-4-13(3)5-6-14-9-12-8-10(14)7-11-2/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | ZANJTHYBWULTPH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |