C10H20N4 — CID 66150121
4-[5-(aminomethyl)imidazol-1-yl]-N,N-dimethylbutan-1-amine (PubChem CID 66150121) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 4-[5-(aminomethyl)imidazol-1-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[5-(aminomethyl)imidazol-1-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 66150121 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 4-[5-(aminomethyl)imidazol-1-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCn1cncc1CN |
| InChI | InChI=1S/C10H20N4/c1-13(2)5-3-4-6-14-9-12-8-10(14)7-11/h8-9H,3-7,11H2,1-2H3 |
| InChIKey | ZIAYHJOJXFBRNE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|