C11H14N4 — CID 66150154
[3-[(3-methyl-2-pyridinyl)methyl]imidazol-4-yl]methanamine (PubChem CID 66150154) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is [3-[(3-methyl-2-pyridinyl)methyl]imidazol-4-yl]methanamine.
| Compound Name | [3-[(3-methyl-2-pyridinyl)methyl]imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 66150154 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | [3-[(3-methyl-2-pyridinyl)methyl]imidazol-4-yl]methanamine |
| SMILES | Cc1cccnc1Cn1cncc1CN |
| InChI | InChI=1S/C11H14N4/c1-9-3-2-4-14-11(9)7-15-8-13-6-10(15)5-12/h2-4,6,8H,5,7,12H2,1H3 |
| InChIKey | GYISXDZTUCPHPY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |