About (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol
(3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol (PubChem CID 66150917) has the molecular formula C11H10N4OS2
and a molecular weight of 278.36 g/mol. Its IUPAC name is (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol.
Molecular Properties
| Compound Name | (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol |
| PubChem CID | 66150917 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol |
| SMILES | Cn1c(CO)cnc1Sc1ncnc2ccsc12 |
| InChI | InChI=1S/C11H10N4OS2/c1-15-7(5-16)4-12-11(15)18-10-9-8(2-3-17-9)13-6-14-10/h2-4,6,16H,5H2,1H3 |
| InChIKey | PPTRIOQMGUNING-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol?
The IUPAC name of (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol (CID 66150917) is (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol.
What is the SMILES notation for (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol?
The canonical SMILES for (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol is Cn1c(CO)cnc1Sc1ncnc2ccsc12.
What is the InChIKey of (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol?
The InChIKey is PPTRIOQMGUNING-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4OS2/c1-15-7(5-16)4-12-11(15)18-10-9-8(2-3-17-9)13-6-14-10/h2-4,6,16H,5H2,1H3.
What are the key properties of (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol?
(3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol has a molecular weight of 278.36 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-thieno[3,2-d]pyrimidin-4-ylsulfanylimidazol-4-yl)methanol is sourced from PubChem (CID 66150917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).