C22H19N3O4S — CID 6615144
ethyl 4-methyl-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 6615144) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 6615144 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | ethyl 4-methyl-2-[[2-(9-oxoacridin-10-yl)acetyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)Cn2c3ccccc3c(=O)c3ccccc32)nc1C |
| InChI | InChI=1S/C22H19N3O4S/c1-3-29-21(28)20-13(2)23-22(30-20)24-18(26)12-25-16-10-6-4-8-14(16)19(27)15-9-5-7-11-17(15)25/h4-11H,3,12H2,1-2H3,(H,23,24,26) |
| InChIKey | VGGGHRAXHZNDKT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|