C13H14N6OS — CID 66151702
[3-methyl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]imidazol-4-yl]methanol (PubChem CID 66151702) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is [3-methyl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]imidazol-4-yl]methanol.
| Compound Name | [3-methyl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 66151702 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [3-methyl-2-[(1-phenyltetrazol-5-yl)methylsulfanyl]imidazol-4-yl]methanol |
| SMILES | Cn1c(CO)cnc1SCc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H14N6OS/c1-18-11(8-20)7-14-13(18)21-9-12-15-16-17-19(12)10-5-3-2-4-6-10/h2-7,20H,8-9H2,1H3 |
| InChIKey | KAAHKHBBWRJWMF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |