C16H21N3O — CID 66151762
N-[[3-[2-(3-methylphenoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine (PubChem CID 66151762) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is N-[[3-[2-(3-methylphenoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3-[2-(3-methylphenoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66151762 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[[3-[2-(3-methylphenoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine |
| SMILES | Cc1cccc(OCCn2cncc2CNC2CC2)c1 |
| InChI | InChI=1S/C16H21N3O/c1-13-3-2-4-16(9-13)20-8-7-19-12-17-10-15(19)11-18-14-5-6-14/h2-4,9-10,12,14,18H,5-8,11H2,1H3 |
| InChIKey | SWOFDDMKUXXACE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |