C11H18F3N3O — CID 66151819
N-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]propan-2-amine (PubChem CID 66151819) has the molecular formula C11H18F3N3O and a molecular weight of 265.28 g/mol. Its IUPAC name is N-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66151819 |
| Molecular Formula | C11H18F3N3O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cncn1CCOCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O/c1-9(2)16-6-10-5-15-8-17(10)3-4-18-7-11(12,13)14/h5,8-9,16H,3-4,6-7H2,1-2H3 |
| InChIKey | AMSRPCVEWQZKCL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|