C14H14N2O4 — CID 66152420
6-[(3-ethylimidazol-4-yl)methoxy]-1,3-benzodioxole-5-carbaldehyde (PubChem CID 66152420) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 6-[(3-ethylimidazol-4-yl)methoxy]-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-[(3-ethylimidazol-4-yl)methoxy]-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 66152420 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 6-[(3-ethylimidazol-4-yl)methoxy]-1,3-benzodioxole-5-carbaldehyde |
| SMILES | CCn1cncc1COc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C14H14N2O4/c1-2-16-8-15-5-11(16)7-18-12-4-14-13(19-9-20-14)3-10(12)6-17/h3-6,8H,2,7,9H2,1H3 |
| InChIKey | BTMBAQOZPBLQBI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|