C13H15N3O — CID 66152915
4-[(3-cyclopropylimidazol-4-yl)methoxy]aniline (PubChem CID 66152915) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-[(3-cyclopropylimidazol-4-yl)methoxy]aniline.
| Compound Name | 4-[(3-cyclopropylimidazol-4-yl)methoxy]aniline |
|---|---|
| PubChem CID | 66152915 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-[(3-cyclopropylimidazol-4-yl)methoxy]aniline |
| SMILES | Nc1ccc(OCc2cncn2C2CC2)cc1 |
| InChI | InChI=1S/C13H15N3O/c14-10-1-5-13(6-2-10)17-8-12-7-15-9-16(12)11-3-4-11/h1-2,5-7,9,11H,3-4,8,14H2 |
| InChIKey | MDUMBGXKYLFGKS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|