C10H13ClN2S — CID 66153924
2-(2-chlorophenyl)sulfanyl-N,N-dimethylethanimidamide (PubChem CID 66153924) has the molecular formula C10H13ClN2S and a molecular weight of 228.75 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N,N-dimethylethanimidamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 66153924 |
| Molecular Formula | C10H13ClN2S |
| Molecular Weight | 228.75 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N,N-dimethylethanimidamide |
| SMILES | [H]/N=C(/CSc1ccccc1Cl)N(C)C |
| InChI | InChI=1S/C10H13ClN2S/c1-13(2)10(12)7-14-9-6-4-3-5-8(9)11/h3-6,12H,7H2,1-2H3/b12-10- |
| InChIKey | IVKDUOOANZMUFG-BENRWUELSA-N |
| XLogP | 2.97 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|