C13H14N2O2S — CID 661542
Quinoxaline, 5,6,7,8-tetrahydro-2-methyl-3-(2-thienyl)-, 1,4-dioxide (PubChem CID 661542) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-methyl-4-oxido-2-thiophen-2-yl-5,6,7,8-tetrahydroquinoxalin-1-ium 1-oxide.
| Compound Name | Quinoxaline, 5,6,7,8-tetrahydro-2-methyl-3-(2-thienyl)-, 1,4-dioxide |
|---|---|
| PubChem CID | 661542 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-methyl-4-oxido-2-thiophen-2-yl-5,6,7,8-tetrahydroquinoxalin-1-ium 1-oxide |
| SMILES | CC1=C([N+](=O)C2=C(N1[O-])CCCC2)C3=CC=CS3 |
| InChI | InChI=1S/C13H14N2O2S/c1-9-13(12-7-4-8-18-12)15(17)11-6-3-2-5-10(11)14(9)16/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | IIMPKJYPPAWWBS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | 456 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|