About 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde
5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde (PubChem CID 66155706) has the molecular formula C16H13ClO2
and a molecular weight of 272.73 g/mol. Its IUPAC name is 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde.
Molecular Properties
| Compound Name | 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde |
| PubChem CID | 66155706 |
| Molecular Formula | C16H13ClO2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde |
| SMILES | CC1Cc2cc(-c3ccc(Cl)cc3C=O)ccc2O1 |
| InChI | InChI=1S/C16H13ClO2/c1-10-6-12-7-11(2-5-16(12)19-10)15-4-3-14(17)8-13(15)9-18/h2-5,7-10H,6H2,1H3 |
| InChIKey | ZTMJKLSLVDANRM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde?
The IUPAC name of 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde (CID 66155706) is 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde.
What is the SMILES notation for 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde?
The canonical SMILES for 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde is CC1Cc2cc(-c3ccc(Cl)cc3C=O)ccc2O1.
What is the InChIKey of 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde?
The InChIKey is ZTMJKLSLVDANRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClO2/c1-10-6-12-7-11(2-5-16(12)19-10)15-4-3-14(17)8-13(15)9-18/h2-5,7-10H,6H2,1H3.
What are the key properties of 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde?
5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde has a molecular weight of 272.73 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)benzaldehyde is sourced from PubChem (CID 66155706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).