C13H12N2O6 — CID 66155835
2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-5-nitrobenzaldehyde (PubChem CID 66155835) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-5-nitrobenzaldehyde.
| Compound Name | 2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-5-nitrobenzaldehyde |
|---|---|
| PubChem CID | 66155835 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-5-nitrobenzaldehyde |
| SMILES | COCc1cc(COc2ccc([N+](=O)[O-])cc2C=O)no1 |
| InChI | InChI=1S/C13H12N2O6/c1-19-8-12-5-10(14-21-12)7-20-13-3-2-11(15(17)18)4-9(13)6-16/h2-6H,7-8H2,1H3 |
| InChIKey | IQOQEDKYQBPHBK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|