About 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid
4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid (PubChem CID 66156033) has the molecular formula C15H17NO5
and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid |
| PubChem CID | 66156033 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid |
| SMILES | COCc1cc(COc2c(C)cc(C(=O)O)cc2C)no1 |
| InChI | InChI=1S/C15H17NO5/c1-9-4-11(15(17)18)5-10(2)14(9)20-7-12-6-13(8-19-3)21-16-12/h4-6H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | IFFSQMBITMFMSS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid?
The IUPAC name of 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid (CID 66156033) is 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid.
What is the SMILES notation for 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid?
The canonical SMILES for 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid is COCc1cc(COc2c(C)cc(C(=O)O)cc2C)no1.
What is the InChIKey of 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid?
The InChIKey is IFFSQMBITMFMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5/c1-9-4-11(15(17)18)5-10(2)14(9)20-7-12-6-13(8-19-3)21-16-12/h4-6H,7-8H2,1-3H3,(H,17,18).
What are the key properties of 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid?
4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid has a molecular weight of 291.30 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(methoxymethyl)-1,2-oxazol-3-yl]methoxy]-3,5-dimethylbenzoic acid is sourced from PubChem (CID 66156033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).