C13H13N3O2S — CID 66156353
N-[(3-carbamothioylphenyl)methyl]-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 66156353) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[(3-carbamothioylphenyl)methyl]-5-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(3-carbamothioylphenyl)methyl]-5-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 66156353 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N-[(3-carbamothioylphenyl)methyl]-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2cccc(C(N)=S)c2)no1 |
| InChI | InChI=1S/C13H13N3O2S/c1-8-5-11(16-18-8)13(17)15-7-9-3-2-4-10(6-9)12(14)19/h2-6H,7H2,1H3,(H2,14,19)(H,15,17) |
| InChIKey | CMNMNFRBWVQWOU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|