About [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride
[5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (PubChem CID 66156812) has the molecular formula C6H8ClNO4S
and a molecular weight of 225.65 g/mol. Its IUPAC name is [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
| PubChem CID | 66156812 |
| Molecular Formula | C6H8ClNO4S |
| Molecular Weight | 225.65 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
| SMILES | COCc1cc(CS(=O)(=O)Cl)no1 |
| InChI | InChI=1S/C6H8ClNO4S/c1-11-3-6-2-5(8-12-6)4-13(7,9)10/h2H,3-4H2,1H3 |
| InChIKey | KDPKJQAMRYMTRW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.65 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
The IUPAC name of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (CID 66156812) is [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
What is the SMILES notation for [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
The canonical SMILES for [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride is COCc1cc(CS(=O)(=O)Cl)no1.
What is the InChIKey of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
The InChIKey is KDPKJQAMRYMTRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNO4S/c1-11-3-6-2-5(8-12-6)4-13(7,9)10/h2H,3-4H2,1H3.
What are the key properties of [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride?
[5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride has a molecular weight of 225.65 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(methoxymethyl)-1,2-oxazol-3-yl]methanesulfonyl chloride is sourced from PubChem (CID 66156812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).