About N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide
N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (PubChem CID 66157343) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 66157343 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NC(C#N)C2CCCCC2)no1 |
| InChI | InChI=1S/C14H19N3O3/c1-19-9-11-7-12(17-20-11)14(18)16-13(8-15)10-5-3-2-4-6-10/h7,10,13H,2-6,9H2,1H3,(H,16,18) |
| InChIKey | ARLSPMLUHJTHDW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide (CID 66157343) is N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide is COCc1cc(C(=O)NC(C#N)C2CCCCC2)no1.
What is the InChIKey of N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
The InChIKey is ARLSPMLUHJTHDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O3/c1-19-9-11-7-12(17-20-11)14(18)16-13(8-15)10-5-3-2-4-6-10/h7,10,13H,2-6,9H2,1H3,(H,16,18).
What are the key properties of N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide?
N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide has a molecular weight of 277.32 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyano(cyclohexyl)methyl]-5-(methoxymethyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 66157343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).