About (5-methyl-1,2-oxazol-3-yl)methylhydrazine
(5-methyl-1,2-oxazol-3-yl)methylhydrazine (PubChem CID 66157923) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methylhydrazine.
Molecular Properties
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methylhydrazine |
| PubChem CID | 66157923 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methylhydrazine |
| SMILES | Cc1cc(CNN)no1 |
| InChI | InChI=1S/C5H9N3O/c1-4-2-5(3-7-6)8-9-4/h2,7H,3,6H2,1H3 |
| InChIKey | NEFVEPWHZDWVIL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-1,2-oxazol-3-yl)methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,2-oxazol-3-yl)methylhydrazine?
The IUPAC name of (5-methyl-1,2-oxazol-3-yl)methylhydrazine (CID 66157923) is (5-methyl-1,2-oxazol-3-yl)methylhydrazine.
What is the SMILES notation for (5-methyl-1,2-oxazol-3-yl)methylhydrazine?
The canonical SMILES for (5-methyl-1,2-oxazol-3-yl)methylhydrazine is Cc1cc(CNN)no1.
What is the InChIKey of (5-methyl-1,2-oxazol-3-yl)methylhydrazine?
The InChIKey is NEFVEPWHZDWVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4-2-5(3-7-6)8-9-4/h2,7H,3,6H2,1H3.
What are the key properties of (5-methyl-1,2-oxazol-3-yl)methylhydrazine?
(5-methyl-1,2-oxazol-3-yl)methylhydrazine has a molecular weight of 127.15 g/mol, XLogP of -0.05, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,2-oxazol-3-yl)methylhydrazine is sourced from PubChem (CID 66157923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).