About 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile
5-(methoxymethyl)-1,2-oxazole-3-carbonitrile (PubChem CID 66157988) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile |
| PubChem CID | 66157988 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile |
| SMILES | COCc1cc(C#N)no1 |
| InChI | InChI=1S/C6H6N2O2/c1-9-4-6-2-5(3-7)8-10-6/h2H,4H2,1H3 |
| InChIKey | VBDPPMZFYTWIOZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile?
The IUPAC name of 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile (CID 66157988) is 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile.
What is the SMILES notation for 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile?
The canonical SMILES for 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile is COCc1cc(C#N)no1.
What is the InChIKey of 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile?
The InChIKey is VBDPPMZFYTWIOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c1-9-4-6-2-5(3-7)8-10-6/h2H,4H2,1H3.
What are the key properties of 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile?
5-(methoxymethyl)-1,2-oxazole-3-carbonitrile has a molecular weight of 138.13 g/mol, XLogP of 0.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-1,2-oxazole-3-carbonitrile is sourced from PubChem (CID 66157988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).