C14H13BrN2O3S — CID 66158855
ethyl 2-[(3-bromophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 66158855) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is ethyl 2-[(3-bromophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[(3-bromophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 66158855 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | ethyl 2-[(3-bromophenyl)sulfanylmethyl]-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CSc2cccc(Br)c2)[nH]c1=O |
| InChI | InChI=1S/C14H13BrN2O3S/c1-2-20-14(19)11-7-16-12(17-13(11)18)8-21-10-5-3-4-9(15)6-10/h3-7H,2,8H2,1H3,(H,16,17,18) |
| InChIKey | FQZSKJZDKYUYNF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |