C16H19N3O2 — CID 66164081
ethyl 2-[(3-cyclopropylimidazol-4-yl)methylamino]benzoate (PubChem CID 66164081) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is ethyl 2-[(3-cyclopropylimidazol-4-yl)methylamino]benzoate.
| Compound Name | ethyl 2-[(3-cyclopropylimidazol-4-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 66164081 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | ethyl 2-[(3-cyclopropylimidazol-4-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NCc1cncn1C1CC1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-21-16(20)14-5-3-4-6-15(14)18-10-13-9-17-11-19(13)12-7-8-12/h3-6,9,11-12,18H,2,7-8,10H2,1H3 |
| InChIKey | UYMMNLMRLFTHST-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |