About [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine
[3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine (PubChem CID 66164181) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine |
| PubChem CID | 66164181 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine |
| SMILES | CC(C)n1cncc1C1=NOC(CN)C1 |
| InChI | InChI=1S/C10H16N4O/c1-7(2)14-6-12-5-10(14)9-3-8(4-11)15-13-9/h5-8H,3-4,11H2,1-2H3 |
| InChIKey | KIMCYEPIKLHQJW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine?
The IUPAC name of [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine (CID 66164181) is [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine.
What is the SMILES notation for [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine?
The canonical SMILES for [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine is CC(C)n1cncc1C1=NOC(CN)C1.
What is the InChIKey of [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine?
The InChIKey is KIMCYEPIKLHQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-7(2)14-6-12-5-10(14)9-3-8(4-11)15-13-9/h5-8H,3-4,11H2,1-2H3.
What are the key properties of [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine?
[3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine has a molecular weight of 208.26 g/mol, XLogP of 0.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-propan-2-ylimidazol-4-yl)-4,5-dihydro-1,2-oxazol-5-yl]methanamine is sourced from PubChem (CID 66164181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).