About 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol
2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 66165891) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol.
Analyze 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol?
The IUPAC name of 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol (CID 66165891) is 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol.
What is the SMILES notation for 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol?
The canonical SMILES for 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol is CCn1c(C)nnc1C(O)CN.
What is the InChIKey of 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol?
The InChIKey is WSECLRFMINBUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c1-3-11-5(2)9-10-7(11)6(12)4-8/h6,12H,3-4,8H2,1-2H3.
What are the key properties of 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol?
2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol has a molecular weight of 170.22 g/mol, XLogP of -0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(4-ethyl-5-methyl-1,2,4-triazol-3-yl)ethanol is sourced from PubChem (CID 66165891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).