About 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol
2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol (PubChem CID 66165893) has the molecular formula C8H16N4O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol |
| PubChem CID | 66165893 |
| Molecular Formula | C8H16N4O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol |
| SMILES | Cc1nnc(C(O)CN)n1C(C)C |
| InChI | InChI=1S/C8H16N4O/c1-5(2)12-6(3)10-11-8(12)7(13)4-9/h5,7,13H,4,9H2,1-3H3 |
| InChIKey | QJBYFTVJAOLATC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol?
The IUPAC name of 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol (CID 66165893) is 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol.
What is the SMILES notation for 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol?
The canonical SMILES for 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol is Cc1nnc(C(O)CN)n1C(C)C.
What is the InChIKey of 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol?
The InChIKey is QJBYFTVJAOLATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O/c1-5(2)12-6(3)10-11-8(12)7(13)4-9/h5,7,13H,4,9H2,1-3H3.
What are the key properties of 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol?
2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol has a molecular weight of 184.24 g/mol, XLogP of 0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(5-methyl-4-propan-2-yl-1,2,4-triazol-3-yl)ethanol is sourced from PubChem (CID 66165893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).