C11H11N3O4 — CID 66166001
2-hydroxy-3-(1H-indazole-6-carbonylamino)propanoic acid (PubChem CID 66166001) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-hydroxy-3-(1H-indazole-6-carbonylamino)propanoic acid.
| Compound Name | 2-hydroxy-3-(1H-indazole-6-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 66166001 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-hydroxy-3-(1H-indazole-6-carbonylamino)propanoic acid |
| SMILES | O=C(NCC(O)C(=O)O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C11H11N3O4/c15-9(11(17)18)5-12-10(16)6-1-2-7-4-13-14-8(7)3-6/h1-4,9,15H,5H2,(H,12,16)(H,13,14)(H,17,18) |
| InChIKey | LQAUUSNUSODPTH-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |