C25H26F3N3O5S — CID 6616643
N-(2-methoxyethyl)-4-[(2-methoxyphenyl)methylamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 6616643) has the molecular formula C25H26F3N3O5S and a molecular weight of 537.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[(2-methoxyphenyl)methylamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-(2-methoxyethyl)-4-[(2-methoxyphenyl)methylamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 6616643 |
| Molecular Formula | C25H26F3N3O5S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | N-(2-methoxyethyl)-4-[(2-methoxyphenyl)methylamino]-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | COCCNC(=O)c1ccc(NCc2ccccc2OC)c(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C25H26F3N3O5S/c1-35-13-12-29-24(32)17-10-11-21(30-16-18-6-3-4-9-22(18)36-2)23(14-17)37(33,34)31-20-8-5-7-19(15-20)25(26,27)28/h3-11,14-15,30-31H,12-13,16H2,1-2H3,(H,29,32) |
| InChIKey | HNKOKLSEHFJGKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|